C23H25NO4 — CID 164678521
tert-butyl (3S)-3-(4-methylphenyl)-2-oxo-3-(3-oxopropyl)indole-1-carboxylate (PubChem CID 164678521) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-(4-methylphenyl)-2-oxo-3-(3-oxopropyl)indole-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(4-methylphenyl)-2-oxo-3-(3-oxopropyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 164678521 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | tert-butyl (3S)-3-(4-methylphenyl)-2-oxo-3-(3-oxopropyl)indole-1-carboxylate |
| SMILES | Cc1ccc([C@]2(CCC=O)C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-16-10-12-17(13-11-16)23(14-7-15-25)18-8-5-6-9-19(18)24(20(23)26)21(27)28-22(2,3)4/h5-6,8-13,15H,7,14H2,1-4H3/t23-/m0/s1 |
| InChIKey | NIXPKCRPVJMWQE-QHCPKHFHSA-N |
| XLogP | 4.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|