C27H27NO4 — CID 101471851
tert-butyl 3-naphthalen-2-yl-2-oxo-3-(3-oxobutyl)indole-1-carboxylate (PubChem CID 101471851) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is tert-butyl 3-naphthalen-2-yl-2-oxo-3-(3-oxobutyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-naphthalen-2-yl-2-oxo-3-(3-oxobutyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 101471851 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | tert-butyl 3-naphthalen-2-yl-2-oxo-3-(3-oxobutyl)indole-1-carboxylate |
| SMILES | CC(=O)CCC1(c2ccc3ccccc3c2)C(=O)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C27H27NO4/c1-18(29)15-16-27(21-14-13-19-9-5-6-10-20(19)17-21)22-11-7-8-12-23(22)28(24(27)30)25(31)32-26(2,3)4/h5-14,17H,15-16H2,1-4H3 |
| InChIKey | OLLOEEKXBLDYOW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |