C27H26FNO5S — CID 56840078
tert-butyl (3R)-3-[2-(benzenesulfonyl)ethyl]-5-fluoro-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 56840078) has the molecular formula C27H26FNO5S and a molecular weight of 495.57 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-(benzenesulfonyl)ethyl]-5-fluoro-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-(benzenesulfonyl)ethyl]-5-fluoro-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 56840078 |
| Molecular Formula | C27H26FNO5S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | tert-butyl (3R)-3-[2-(benzenesulfonyl)ethyl]-5-fluoro-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@](CCS(=O)(=O)c2ccccc2)(c2ccccc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C27H26FNO5S/c1-26(2,3)34-25(31)29-23-15-14-20(28)18-22(23)27(24(29)30,19-10-6-4-7-11-19)16-17-35(32,33)21-12-8-5-9-13-21/h4-15,18H,16-17H2,1-3H3/t27-/m1/s1 |
| InChIKey | MMXPELBYSCGZRR-HHHXNRCGSA-N |
| XLogP | 5.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |