C16H16Br2FNO5 — CID 135066143
tert-butyl (3R)-3-bromo-3-[(1S)-1-bromo-2-methoxy-2-oxoethyl]-5-fluoro-2-oxoindole-1-carboxylate (PubChem CID 135066143) has the molecular formula C16H16Br2FNO5 and a molecular weight of 481.11 g/mol. Its IUPAC name is tert-butyl (3R)-3-bromo-3-[(1S)-1-bromo-2-methoxy-2-oxoethyl]-5-fluoro-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-bromo-3-[(1S)-1-bromo-2-methoxy-2-oxoethyl]-5-fluoro-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 135066143 |
| Molecular Formula | C16H16Br2FNO5 |
| Molecular Weight | 481.11 g/mol |
| Exact Mass | 478.94 |
| IUPAC Name | tert-butyl (3R)-3-bromo-3-[(1S)-1-bromo-2-methoxy-2-oxoethyl]-5-fluoro-2-oxoindole-1-carboxylate |
| SMILES | COC(=O)[C@H](Br)[C@]1(Br)C(=O)N(C(=O)OC(C)(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C16H16Br2FNO5/c1-15(2,3)25-14(23)20-10-6-5-8(19)7-9(10)16(18,13(20)22)11(17)12(21)24-4/h5-7,11H,1-4H3/t11-,16-/m0/s1 |
| InChIKey | WBAAYXBLVGDBLW-ZBEGNZNMSA-N |
| XLogP | 3.63 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.11 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|