C17H22BrNO3 — CID 172600879
tert-butyl 6-bromo-3,3-diethyl-2-oxoindole-1-carboxylate (PubChem CID 172600879) has the molecular formula C17H22BrNO3 and a molecular weight of 368.27 g/mol. Its IUPAC name is tert-butyl 6-bromo-3,3-diethyl-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl 6-bromo-3,3-diethyl-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 172600879 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | tert-butyl 6-bromo-3,3-diethyl-2-oxoindole-1-carboxylate |
| SMILES | CCC1(CC)C(=O)N(C(=O)OC(C)(C)C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C17H22BrNO3/c1-6-17(7-2)12-9-8-11(18)10-13(12)19(14(17)20)15(21)22-16(3,4)5/h8-10H,6-7H2,1-5H3 |
| InChIKey | BMBPVVMVJKYOOI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |