C24H29NO9 — CID 132516509
1-O',2-O-ditert-butyl 1-O,1-O'-dimethyl 2'-oxospiro[cyclopropane-3,3'-indole]-1,1,1',2-tetracarboxylate (PubChem CID 132516509) has the molecular formula C24H29NO9 and a molecular weight of 475.49 g/mol. Its IUPAC name is 1-O',2-O-ditert-butyl 1-O,1-O'-dimethyl 2'-oxospiro[cyclopropane-3,3'-indole]-1,1,1',2-tetracarboxylate.
| Compound Name | 1-O',2-O-ditert-butyl 1-O,1-O'-dimethyl 2'-oxospiro[cyclopropane-3,3'-indole]-1,1,1',2-tetracarboxylate |
|---|---|
| PubChem CID | 132516509 |
| Molecular Formula | C24H29NO9 |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-O',2-O-ditert-butyl 1-O,1-O'-dimethyl 2'-oxospiro[cyclopropane-3,3'-indole]-1,1,1',2-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(C(=O)OC(C)(C)C)C12C(=O)N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C24H29NO9/c1-21(2,3)33-16(26)15-23(24(15,18(28)31-7)19(29)32-8)13-11-9-10-12-14(13)25(17(23)27)20(30)34-22(4,5)6/h9-12,15H,1-8H3 |
| InChIKey | RFUIYSWTJZABQR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|