C33H45N3O7 — CID 102262764
tert-butyl (3R)-3-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxoindole-1-carboxylate (PubChem CID 102262764) has the molecular formula C33H45N3O7 and a molecular weight of 595.74 g/mol. Its IUPAC name is tert-butyl (3R)-3-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 102262764 |
| Molecular Formula | C33H45N3O7 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | tert-butyl (3R)-3-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-2-oxoindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)[C@@]1(c2ccc(C(C)(C)C)cc2)C(=O)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C33H45N3O7/c1-29(2,3)21-17-19-22(20-18-21)33(36(28(40)43-32(10,11)12)34-26(38)41-30(4,5)6)23-15-13-14-16-24(23)35(25(33)37)27(39)42-31(7,8)9/h13-20H,1-12H3,(H,34,38)/t33-/m1/s1 |
| InChIKey | QPHYKZJNSZSQEE-MGBGTMOVSA-N |
| XLogP | 7.19 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|