C34H39N3O6 — CID 175130994
tert-butyl N-[(4S)-2-benzyl-4-(3,4-dimethylphenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 175130994) has the molecular formula C34H39N3O6 and a molecular weight of 585.70 g/mol. Its IUPAC name is tert-butyl N-[(4S)-2-benzyl-4-(3,4-dimethylphenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(4S)-2-benzyl-4-(3,4-dimethylphenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 175130994 |
| Molecular Formula | C34H39N3O6 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | tert-butyl N-[(4S)-2-benzyl-4-(3,4-dimethylphenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | Cc1ccc([C@@]2(N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)N(Cc3ccccc3)C(=O)c3ccccc32)cc1C |
| InChI | InChI=1S/C34H39N3O6/c1-22-18-19-25(20-23(22)2)34(37(31(41)43-33(6,7)8)35-30(40)42-32(3,4)5)27-17-13-12-16-26(27)28(38)36(29(34)39)21-24-14-10-9-11-15-24/h9-20H,21H2,1-8H3,(H,35,40)/t34-/m0/s1 |
| InChIKey | OBYMWCBLIGWXRB-UMSFTDKQSA-N |
| XLogP | 6.41 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|