C32H33Cl2N3O6 — CID 175132884
tert-butyl N-[2-benzyl-4-(3,4-dichlorophenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 175132884) has the molecular formula C32H33Cl2N3O6 and a molecular weight of 626.54 g/mol. Its IUPAC name is tert-butyl N-[2-benzyl-4-(3,4-dichlorophenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[2-benzyl-4-(3,4-dichlorophenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 175132884 |
| Molecular Formula | C32H33Cl2N3O6 |
| Molecular Weight | 626.54 g/mol |
| Exact Mass | 625.17 |
| IUPAC Name | tert-butyl N-[2-benzyl-4-(3,4-dichlorophenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)C1(c2ccc(Cl)c(Cl)c2)C(=O)N(Cc2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C32H33Cl2N3O6/c1-30(2,3)42-28(40)35-37(29(41)43-31(4,5)6)32(21-16-17-24(33)25(34)18-21)23-15-11-10-14-22(23)26(38)36(27(32)39)19-20-12-8-7-9-13-20/h7-18H,19H2,1-6H3,(H,35,40) |
| InChIKey | MYGKSUVILFTYHH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.54 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|