C28H29N7O12 — CID 157437856
tert-butyl N-[(3,5-dinitrophenyl)methyl]carbamate;2-[(3,5-dinitrophenyl)methyl]isoindole-1,3-dione;methanamine (PubChem CID 157437856) has the molecular formula C28H29N7O12 and a molecular weight of 655.58 g/mol. Its IUPAC name is tert-butyl N-[(3,5-dinitrophenyl)methyl]carbamate;2-[(3,5-dinitrophenyl)methyl]isoindole-1,3-dione;methanamine.
| Compound Name | tert-butyl N-[(3,5-dinitrophenyl)methyl]carbamate;2-[(3,5-dinitrophenyl)methyl]isoindole-1,3-dione;methanamine |
|---|---|
| PubChem CID | 157437856 |
| Molecular Formula | C28H29N7O12 |
| Molecular Weight | 655.58 g/mol |
| Exact Mass | 655.19 |
| IUPAC Name | tert-butyl N-[(3,5-dinitrophenyl)methyl]carbamate;2-[(3,5-dinitrophenyl)methyl]isoindole-1,3-dione;methanamine |
| SMILES | CC(C)(C)OC(=O)NCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.CN.O=C1c2ccccc2C(=O)N1Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9N3O6.C12H15N3O6.CH5N/c19-14-12-3-1-2-4-13(12)15(20)16(14)8-9-5-10(17(21)22)7-11(6-9)18(23)24;1-12(2,3)21-11(16)13-7-8-4-9(14(17)18)6-10(5-8)15(19)20;1-2/h1-7H,8H2;4-6H,7H2,1-3H3,(H,13,16);2H2,1H3 |
| InChIKey | BRHYIVIUHVBADM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 274.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|