C14H16N2O4 — CID 138985725
tert-butyl N-[(3-ethynyl-5-nitrophenyl)methyl]carbamate (PubChem CID 138985725) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is tert-butyl N-[(3-ethynyl-5-nitrophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-ethynyl-5-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 138985725 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | tert-butyl N-[(3-ethynyl-5-nitrophenyl)methyl]carbamate |
| SMILES | C#Cc1cc(CNC(=O)OC(C)(C)C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N2O4/c1-5-10-6-11(8-12(7-10)16(18)19)9-15-13(17)20-14(2,3)4/h1,6-8H,9H2,2-4H3,(H,15,17) |
| InChIKey | UASVQZFNCMXSEA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|