C14H16F2N2O4 — CID 126644009
tert-butyl N-[[3,5-difluoro-4-[(E)-2-nitroethenyl]phenyl]methyl]carbamate (PubChem CID 126644009) has the molecular formula C14H16F2N2O4 and a molecular weight of 314.29 g/mol. Its IUPAC name is tert-butyl N-[[3,5-difluoro-4-[(E)-2-nitroethenyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3,5-difluoro-4-[(E)-2-nitroethenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 126644009 |
| Molecular Formula | C14H16F2N2O4 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | tert-butyl N-[[3,5-difluoro-4-[(E)-2-nitroethenyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(F)c(/C=C/[N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C14H16F2N2O4/c1-14(2,3)22-13(19)17-8-9-6-11(15)10(12(16)7-9)4-5-18(20)21/h4-7H,8H2,1-3H3,(H,17,19)/b5-4+ |
| InChIKey | WEKHFNWOVKNRHH-SNAWJCMRSA-N |
| XLogP | 3.24 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|