C13H13F2NO4 — CID 165354172
tert-butyl 3,5-difluoro-4-(2-nitroethenyl)benzoate (PubChem CID 165354172) has the molecular formula C13H13F2NO4 and a molecular weight of 285.25 g/mol. Its IUPAC name is tert-butyl 3,5-difluoro-4-(2-nitroethenyl)benzoate.
| Compound Name | tert-butyl 3,5-difluoro-4-(2-nitroethenyl)benzoate |
|---|---|
| PubChem CID | 165354172 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | tert-butyl 3,5-difluoro-4-(2-nitroethenyl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(F)c(C=C[N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C13H13F2NO4/c1-13(2,3)20-12(17)8-6-10(14)9(11(15)7-8)4-5-16(18)19/h4-7H,1-3H3 |
| InChIKey | HRYKYQORNMSILL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|