C9H7F2NO3 — CID 142352492
1,3-difluoro-2-[(E)-2-nitroethenyl]-5-(trideuteriomethoxy)benzene (PubChem CID 142352492) has the molecular formula C9H7F2NO3 and a molecular weight of 218.17 g/mol. Its IUPAC name is 1,3-difluoro-2-[(E)-2-nitroethenyl]-5-(trideuteriomethoxy)benzene.
| Compound Name | 1,3-difluoro-2-[(E)-2-nitroethenyl]-5-(trideuteriomethoxy)benzene |
|---|---|
| PubChem CID | 142352492 |
| Molecular Formula | C9H7F2NO3 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 1,3-difluoro-2-[(E)-2-nitroethenyl]-5-(trideuteriomethoxy)benzene |
| SMILES | [2H]C([2H])([2H])Oc1cc(F)c(/C=C/[N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C9H7F2NO3/c1-15-6-4-8(10)7(9(11)5-6)2-3-12(13)14/h2-5H,1H3/b3-2+/i1D3 |
| InChIKey | TUJQVDNFDKDGQA-SMQGVBCRSA-N |
| XLogP | 2.22 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|