C9H7F2NO2 — CID 126653279
1,4-difluoro-2-methyl-5-[(E)-2-nitroethenyl]benzene (PubChem CID 126653279) has the molecular formula C9H7F2NO2 and a molecular weight of 199.16 g/mol. Its IUPAC name is 1,4-difluoro-2-methyl-5-[(E)-2-nitroethenyl]benzene.
| Compound Name | 1,4-difluoro-2-methyl-5-[(E)-2-nitroethenyl]benzene |
|---|---|
| PubChem CID | 126653279 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 1,4-difluoro-2-methyl-5-[(E)-2-nitroethenyl]benzene |
| SMILES | Cc1cc(F)c(/C=C/[N+](=O)[O-])cc1F |
| InChI | InChI=1S/C9H7F2NO2/c1-6-4-9(11)7(5-8(6)10)2-3-12(13)14/h2-5H,1H3/b3-2+ |
| InChIKey | KWWYDSCAPKEGQF-NSCUHMNNSA-N |
| XLogP | 2.52 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|