C8H9NO2S — CID 76913006
2,5-dimethyl-3-(2-nitroethenyl)thiophene (PubChem CID 76913006) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 2,5-dimethyl-3-(2-nitroethenyl)thiophene.
| Compound Name | 2,5-dimethyl-3-(2-nitroethenyl)thiophene |
|---|---|
| PubChem CID | 76913006 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 2,5-dimethyl-3-(2-nitroethenyl)thiophene |
| SMILES | Cc1cc(C=C[N+](=O)[O-])c(C)s1 |
| InChI | InChI=1S/C8H9NO2S/c1-6-5-8(7(2)12-6)3-4-9(10)11/h3-5H,1-2H3 |
| InChIKey | YPGHMUQHKDWDKU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|