C12H11NO2S — CID 135380422
2,7-dimethyl-3-[(E)-2-nitroethenyl]-1-benzothiophene (PubChem CID 135380422) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2,7-dimethyl-3-[(E)-2-nitroethenyl]-1-benzothiophene.
| Compound Name | 2,7-dimethyl-3-[(E)-2-nitroethenyl]-1-benzothiophene |
|---|---|
| PubChem CID | 135380422 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2,7-dimethyl-3-[(E)-2-nitroethenyl]-1-benzothiophene |
| SMILES | Cc1sc2c(C)cccc2c1/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C12H11NO2S/c1-8-4-3-5-11-10(6-7-13(14)15)9(2)16-12(8)11/h3-7H,1-2H3/b7-6+ |
| InChIKey | SBGCKHVTDWZTIE-VOTSOKGWSA-N |
| XLogP | 3.77 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|