C10H10FNO4 — CID 10513470
1-fluoro-3,4-dimethoxy-2-[(E)-2-nitroethenyl]benzene (PubChem CID 10513470) has the molecular formula C10H10FNO4 and a molecular weight of 227.19 g/mol. Its IUPAC name is 1-fluoro-3,4-dimethoxy-2-[(E)-2-nitroethenyl]benzene.
| Compound Name | 1-fluoro-3,4-dimethoxy-2-[(E)-2-nitroethenyl]benzene |
|---|---|
| PubChem CID | 10513470 |
| Molecular Formula | C10H10FNO4 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 1-fluoro-3,4-dimethoxy-2-[(E)-2-nitroethenyl]benzene |
| SMILES | COc1ccc(F)c(/C=C/[N+](=O)[O-])c1OC |
| InChI | InChI=1S/C10H10FNO4/c1-15-9-4-3-8(11)7(10(9)16-2)5-6-12(13)14/h3-6H,1-2H3/b6-5+ |
| InChIKey | SUXIWIWGQOIUIZ-AATRIKPKSA-N |
| XLogP | 2.09 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|