C10H10ClNO4 — CID 54212872
3-chloro-1,2-dimethoxy-4-(2-nitroethenyl)benzene (PubChem CID 54212872) has the molecular formula C10H10ClNO4 and a molecular weight of 243.65 g/mol. Its IUPAC name is 3-chloro-1,2-dimethoxy-4-(2-nitroethenyl)benzene.
| Compound Name | 3-chloro-1,2-dimethoxy-4-(2-nitroethenyl)benzene |
|---|---|
| PubChem CID | 54212872 |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 3-chloro-1,2-dimethoxy-4-(2-nitroethenyl)benzene |
| SMILES | COc1ccc(C=C[N+](=O)[O-])c(Cl)c1OC |
| InChI | InChI=1S/C10H10ClNO4/c1-15-8-4-3-7(5-6-12(13)14)9(11)10(8)16-2/h3-6H,1-2H3 |
| InChIKey | PXDQNCVFROGRNW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|