C11H13ClO3 — CID 163198757
(E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-en-1-ol (PubChem CID 163198757) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is (E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-en-1-ol.
| Compound Name | (E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 163198757 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-en-1-ol |
| SMILES | COc1ccc(/C=C/CO)c(Cl)c1OC |
| InChI | InChI=1S/C11H13ClO3/c1-14-9-6-5-8(4-3-7-13)10(12)11(9)15-2/h3-6,13H,7H2,1-2H3/b4-3+ |
| InChIKey | LFZQZAABJUHQTG-ONEGZZNKSA-N |
| XLogP | 2.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |