C9H7Cl3O — CID 173058709
(E)-3-(2,3,4-trichlorophenyl)prop-2-en-1-ol (PubChem CID 173058709) has the molecular formula C9H7Cl3O and a molecular weight of 237.51 g/mol. Its IUPAC name is (E)-3-(2,3,4-trichlorophenyl)prop-2-en-1-ol.
| Compound Name | (E)-3-(2,3,4-trichlorophenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 173058709 |
| Molecular Formula | C9H7Cl3O |
| Molecular Weight | 237.51 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | (E)-3-(2,3,4-trichlorophenyl)prop-2-en-1-ol |
| SMILES | OC/C=C/c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl3O/c10-7-4-3-6(2-1-5-13)8(11)9(7)12/h1-4,13H,5H2/b2-1+ |
| InChIKey | UZIUTHPSAXYMKN-OWOJBTEDSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|