C8H7Cl2NO — CID 169453079
3-(3,5-dichloro-4-pyridinyl)prop-2-en-1-ol (PubChem CID 169453079) has the molecular formula C8H7Cl2NO and a molecular weight of 204.06 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-pyridinyl)prop-2-en-1-ol.
| Compound Name | 3-(3,5-dichloro-4-pyridinyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 169453079 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 3-(3,5-dichloro-4-pyridinyl)prop-2-en-1-ol |
| SMILES | OCC=Cc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C8H7Cl2NO/c9-7-4-11-5-8(10)6(7)2-1-3-12/h1-2,4-5,12H,3H2 |
| InChIKey | PJJRUTZXKHKQGN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |