C19H14Cl4O — CID 141017477
1,7-bis(2,3-dichlorophenyl)hepta-1,6-dien-4-one (PubChem CID 141017477) has the molecular formula C19H14Cl4O and a molecular weight of 400.13 g/mol. Its IUPAC name is 1,7-bis(2,3-dichlorophenyl)hepta-1,6-dien-4-one.
| Compound Name | 1,7-bis(2,3-dichlorophenyl)hepta-1,6-dien-4-one |
|---|---|
| PubChem CID | 141017477 |
| Molecular Formula | C19H14Cl4O |
| Molecular Weight | 400.13 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 1,7-bis(2,3-dichlorophenyl)hepta-1,6-dien-4-one |
| SMILES | O=C(CC=Cc1cccc(Cl)c1Cl)CC=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H14Cl4O/c20-16-11-3-7-13(18(16)22)5-1-9-15(24)10-2-6-14-8-4-12-17(21)19(14)23/h1-8,11-12H,9-10H2 |
| InChIKey | BDRVPTKWXGLEGC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.13 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |