C15H9Cl2IO — CID 3472097
3-(2,3-dichlorophenyl)-1-(4-iodophenyl)prop-2-en-1-one (PubChem CID 3472097) has the molecular formula C15H9Cl2IO and a molecular weight of 403.05 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-(4-iodophenyl)prop-2-en-1-one.
| Compound Name | 3-(2,3-dichlorophenyl)-1-(4-iodophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3472097 |
| Molecular Formula | C15H9Cl2IO |
| Molecular Weight | 403.05 g/mol |
| Exact Mass | 401.91 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-(4-iodophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc(Cl)c1Cl)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H9Cl2IO/c16-13-3-1-2-11(15(13)17)6-9-14(19)10-4-7-12(18)8-5-10/h1-9H |
| InChIKey | GPNOMGJNPGHDPI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.05 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|