C13H11Cl2NO3 — CID 112746556
(E)-4-[[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]but-2-enoic acid (PubChem CID 112746556) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is (E)-4-[[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]but-2-enoic acid.
| Compound Name | (E)-4-[[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 112746556 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | (E)-4-[[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CNC(=O)/C=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H11Cl2NO3/c14-10-4-1-3-9(13(10)15)6-7-11(17)16-8-2-5-12(18)19/h1-7H,8H2,(H,16,17)(H,18,19)/b5-2+,7-6+ |
| InChIKey | BCRZUFAYNWXCEN-IKEBSSOGSA-N |
| XLogP | 2.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|