C16H14Cl2N2O — CID 74607566
3-(2,3-dichlorophenyl)-N-(2-pyridin-2-ylethyl)prop-2-enamide (PubChem CID 74607566) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-N-(2-pyridin-2-ylethyl)prop-2-enamide.
| Compound Name | 3-(2,3-dichlorophenyl)-N-(2-pyridin-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 74607566 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-N-(2-pyridin-2-ylethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(Cl)c1Cl)NCCc1ccccn1 |
| InChI | InChI=1S/C16H14Cl2N2O/c17-14-6-3-4-12(16(14)18)7-8-15(21)20-11-9-13-5-1-2-10-19-13/h1-8,10H,9,11H2,(H,20,21) |
| InChIKey | PIZWQTYRHLWTBL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|