(E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid

C11H10Cl2N2O3 — CID 112746635

IUPAC(E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid
SMILESO=C(O)/C=C/CNC(=O)Nc1cccc(Cl)c1Cl
InChIInChI=1S/C11H10Cl2N2O3/c12-7-3-1-4-8(10(7)13)15-11(18)14-6-2-5-9(16)17/h1-5H,6H2,(H,16,17)(H2,14,15,18)/b5-2+
InChIKeyOMJPPWZPWHWGKP-GORDUTHDSA-N
MW289.12 g/mol
LogP2.76
Rot. Bonds4

About (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid

(E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid (PubChem CID 112746635) has the molecular formula C11H10Cl2N2O3 and a molecular weight of 289.12 g/mol. Its IUPAC name is (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid.

Molecular Properties

Compound Name(E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid
PubChem CID112746635
Molecular FormulaC11H10Cl2N2O3
Molecular Weight289.12 g/mol
Exact Mass288.01
IUPAC Name(E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid
SMILESO=C(O)/C=C/CNC(=O)Nc1cccc(Cl)c1Cl
InChIInChI=1S/C11H10Cl2N2O3/c12-7-3-1-4-8(10(7)13)15-11(18)14-6-2-5-9(16)17/h1-5H,6H2,(H,16,17)(H2,14,15,18)/b5-2+
InChIKeyOMJPPWZPWHWGKP-GORDUTHDSA-N
XLogP2.76
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.12
LogP ≤ 52.76
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid?
The IUPAC name of (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid (CID 112746635) is (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid.
What is the SMILES notation for (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid?
The canonical SMILES for (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid is O=C(O)/C=C/CNC(=O)Nc1cccc(Cl)c1Cl.
What is the InChIKey of (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid?
The InChIKey is OMJPPWZPWHWGKP-GORDUTHDSA-N. The full InChI is InChI=1S/C11H10Cl2N2O3/c12-7-3-1-4-8(10(7)13)15-11(18)14-6-2-5-9(16)17/h1-5H,6H2,(H,16,17)(H2,14,15,18)/b5-2+.
What are the key properties of (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid?
(E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid has a molecular weight of 289.12 g/mol, XLogP of 2.76, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[(2,3-dichlorophenyl)carbamoylamino]but-2-enoic acid is sourced from PubChem (CID 112746635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).