C18H17Cl2NO3 — CID 55595605
(E)-3-(2,3-dichlorophenyl)-N-[(3,5-dimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 55595605) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-N-[(3,5-dimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-N-[(3,5-dimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55595605 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-N-[(3,5-dimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1cc(CNC(=O)/C=C/c2cccc(Cl)c2Cl)cc(OC)c1 |
| InChI | InChI=1S/C18H17Cl2NO3/c1-23-14-8-12(9-15(10-14)24-2)11-21-17(22)7-6-13-4-3-5-16(19)18(13)20/h3-10H,11H2,1-2H3,(H,21,22)/b7-6+ |
| InChIKey | OKYKBWIBRILJPE-VOTSOKGWSA-N |
| XLogP | 4.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|