C10H10Cl2S — CID 170477864
4-(2,3-dichlorophenyl)but-3-ene-1-thiol (PubChem CID 170477864) has the molecular formula C10H10Cl2S and a molecular weight of 233.16 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)but-3-ene-1-thiol.
| Compound Name | 4-(2,3-dichlorophenyl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170477864 |
| Molecular Formula | C10H10Cl2S |
| Molecular Weight | 233.16 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | 4-(2,3-dichlorophenyl)but-3-ene-1-thiol |
| SMILES | SCCC=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl2S/c11-9-6-3-5-8(10(9)12)4-1-2-7-13/h1,3-6,13H,2,7H2 |
| InChIKey | FIXRLURAGHOYQS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.16 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|