C9H7Cl3 — CID 79334722
1,2-dichloro-3-(3-chloroprop-1-enyl)benzene (PubChem CID 79334722) has the molecular formula C9H7Cl3 and a molecular weight of 221.51 g/mol. Its IUPAC name is 1,2-dichloro-3-(3-chloroprop-1-enyl)benzene.
| Compound Name | 1,2-dichloro-3-(3-chloroprop-1-enyl)benzene |
|---|---|
| PubChem CID | 79334722 |
| Molecular Formula | C9H7Cl3 |
| Molecular Weight | 221.51 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | 1,2-dichloro-3-(3-chloroprop-1-enyl)benzene |
| SMILES | ClCC=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl3/c10-6-2-4-7-3-1-5-8(11)9(7)12/h1-5H,6H2 |
| InChIKey | PTFIGJZAWQYYTF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|