C9H7ClF2 — CID 131874054
1-[(E)-3-chloroprop-1-enyl]-2,3-difluorobenzene (PubChem CID 131874054) has the molecular formula C9H7ClF2 and a molecular weight of 188.60 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-1-enyl]-2,3-difluorobenzene.
| Compound Name | 1-[(E)-3-chloroprop-1-enyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 131874054 |
| Molecular Formula | C9H7ClF2 |
| Molecular Weight | 188.60 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 1-[(E)-3-chloroprop-1-enyl]-2,3-difluorobenzene |
| SMILES | Fc1cccc(/C=C/CCl)c1F |
| InChI | InChI=1S/C9H7ClF2/c10-6-2-4-7-3-1-5-8(11)9(7)12/h1-5H,6H2/b4-2+ |
| InChIKey | WDLYVUDYLFIRTJ-DUXPYHPUSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|