C8H7F2O3P — CID 155391982
[(E)-2-(2,3-difluorophenyl)ethenyl]phosphonic acid (PubChem CID 155391982) has the molecular formula C8H7F2O3P and a molecular weight of 220.11 g/mol. Its IUPAC name is [(E)-2-(2,3-difluorophenyl)ethenyl]phosphonic acid.
| Compound Name | [(E)-2-(2,3-difluorophenyl)ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 155391982 |
| Molecular Formula | C8H7F2O3P |
| Molecular Weight | 220.11 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | [(E)-2-(2,3-difluorophenyl)ethenyl]phosphonic acid |
| SMILES | O=P(O)(O)/C=C/c1cccc(F)c1F |
| InChI | InChI=1S/C8H7F2O3P/c9-7-3-1-2-6(8(7)10)4-5-14(11,12)13/h1-5H,(H2,11,12,13)/b5-4+ |
| InChIKey | QNVPDRSLFPIGOH-SNAWJCMRSA-N |
| XLogP | 2.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.11 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|