(2,3-difluorophenyl)-fluorophosphinic acid

C6H4F3O2P — CID 146290655

IUPAC(2,3-difluorophenyl)-fluorophosphinic acid
SMILESO=P(O)(F)c1cccc(F)c1F
InChIInChI=1S/C6H4F3O2P/c7-4-2-1-3-5(6(4)8)12(9,10)11/h1-3H,(H,10,11)
InChIKeyANQMFVHJHMUCMU-UHFFFAOYSA-N
MW196.06 g/mol
LogP1.75
Rot. Bonds1

About (2,3-difluorophenyl)-fluorophosphinic acid

(2,3-difluorophenyl)-fluorophosphinic acid (PubChem CID 146290655) has the molecular formula C6H4F3O2P and a molecular weight of 196.06 g/mol. Its IUPAC name is (2,3-difluorophenyl)-fluorophosphinic acid.

Molecular Properties

Compound Name(2,3-difluorophenyl)-fluorophosphinic acid
PubChem CID146290655
Molecular FormulaC6H4F3O2P
Molecular Weight196.06 g/mol
Exact Mass195.99
IUPAC Name(2,3-difluorophenyl)-fluorophosphinic acid
SMILESO=P(O)(F)c1cccc(F)c1F
InChIInChI=1S/C6H4F3O2P/c7-4-2-1-3-5(6(4)8)12(9,10)11/h1-3H,(H,10,11)
InChIKeyANQMFVHJHMUCMU-UHFFFAOYSA-N
XLogP1.75
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.06
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (2,3-difluorophenyl)-fluorophosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-difluorophenyl)-fluorophosphinic acid?
The IUPAC name of (2,3-difluorophenyl)-fluorophosphinic acid (CID 146290655) is (2,3-difluorophenyl)-fluorophosphinic acid.
What is the SMILES notation for (2,3-difluorophenyl)-fluorophosphinic acid?
The canonical SMILES for (2,3-difluorophenyl)-fluorophosphinic acid is O=P(O)(F)c1cccc(F)c1F.
What is the InChIKey of (2,3-difluorophenyl)-fluorophosphinic acid?
The InChIKey is ANQMFVHJHMUCMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3O2P/c7-4-2-1-3-5(6(4)8)12(9,10)11/h1-3H,(H,10,11).
What are the key properties of (2,3-difluorophenyl)-fluorophosphinic acid?
(2,3-difluorophenyl)-fluorophosphinic acid has a molecular weight of 196.06 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluorophenyl)-fluorophosphinic acid is sourced from PubChem (CID 146290655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).