C6H3F4N — CID 25090604
N,N,2,3-tetrafluoroaniline (PubChem CID 25090604) has the molecular formula C6H3F4N and a molecular weight of 165.09 g/mol. Its IUPAC name is N,N,2,3-tetrafluoroaniline.
| Compound Name | N,N,2,3-tetrafluoroaniline |
|---|---|
| PubChem CID | 25090604 |
| Molecular Formula | C6H3F4N |
| Molecular Weight | 165.09 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | N,N,2,3-tetrafluoroaniline |
| SMILES | Fc1cccc(N(F)F)c1F |
| InChI | InChI=1S/C6H3F4N/c7-4-2-1-3-5(6(4)8)11(9)10/h1-3H |
| InChIKey | BBSAWGCXRLVOAD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.09 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|