C9H6F3NO2 — CID 151159871
2-(N,2,3-trifluoroanilino)prop-2-enoic acid (PubChem CID 151159871) has the molecular formula C9H6F3NO2 and a molecular weight of 217.15 g/mol. Its IUPAC name is 2-(N,2,3-trifluoroanilino)prop-2-enoic acid.
| Compound Name | 2-(N,2,3-trifluoroanilino)prop-2-enoic acid |
|---|---|
| PubChem CID | 151159871 |
| Molecular Formula | C9H6F3NO2 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-(N,2,3-trifluoroanilino)prop-2-enoic acid |
| SMILES | C=C(C(=O)O)N(F)c1cccc(F)c1F |
| InChI | InChI=1S/C9H6F3NO2/c1-5(9(14)15)13(12)7-4-2-3-6(10)8(7)11/h2-4H,1H2,(H,14,15) |
| InChIKey | NAAOITSLMLBGNL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|