C8H4BrF4NO — CID 154376960
2-bromo-N,2,2-trifluoro-N-(2-fluorophenyl)acetamide (PubChem CID 154376960) has the molecular formula C8H4BrF4NO and a molecular weight of 286.02 g/mol. Its IUPAC name is 2-bromo-N,2,2-trifluoro-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-bromo-N,2,2-trifluoro-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 154376960 |
| Molecular Formula | C8H4BrF4NO |
| Molecular Weight | 286.02 g/mol |
| Exact Mass | 284.94 |
| IUPAC Name | 2-bromo-N,2,2-trifluoro-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(N(F)c1ccccc1F)C(F)(F)Br |
| InChI | InChI=1S/C8H4BrF4NO/c9-8(11,12)7(15)14(13)6-4-2-1-3-5(6)10/h1-4H |
| InChIKey | BQBJJGGLYSSECJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.02 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|