C12H18FN — CID 67920255
2-fluoro-N,N-di(propan-2-yl)aniline (PubChem CID 67920255) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 2-fluoro-N,N-di(propan-2-yl)aniline.
| Compound Name | 2-fluoro-N,N-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 67920255 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2-fluoro-N,N-di(propan-2-yl)aniline |
| SMILES | CC(C)N(c1ccccc1F)C(C)C |
| InChI | InChI=1S/C12H18FN/c1-9(2)14(10(3)4)12-8-6-5-7-11(12)13/h5-10H,1-4H3 |
| InChIKey | UBKYZLBHEVUCJB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |