C13H18FNO2 — CID 79192047
N-ethyl-N-(2-fluorophenyl)-4-hydroxypentanamide (PubChem CID 79192047) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is N-ethyl-N-(2-fluorophenyl)-4-hydroxypentanamide.
| Compound Name | N-ethyl-N-(2-fluorophenyl)-4-hydroxypentanamide |
|---|---|
| PubChem CID | 79192047 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-ethyl-N-(2-fluorophenyl)-4-hydroxypentanamide |
| SMILES | CCN(C(=O)CCC(C)O)c1ccccc1F |
| InChI | InChI=1S/C13H18FNO2/c1-3-15(13(17)9-8-10(2)16)12-7-5-4-6-11(12)14/h4-7,10,16H,3,8-9H2,1-2H3 |
| InChIKey | ZUNTXHYRDLKHOY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |