C15H20FNO3 — CID 62934429
5-(N-ethyl-2-fluoroanilino)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 62934429) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 5-(N-ethyl-2-fluoroanilino)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(N-ethyl-2-fluoroanilino)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62934429 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-(N-ethyl-2-fluoroanilino)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CCN(C(=O)CC(C)(C)CC(=O)O)c1ccccc1F |
| InChI | InChI=1S/C15H20FNO3/c1-4-17(12-8-6-5-7-11(12)16)13(18)9-15(2,3)10-14(19)20/h5-8H,4,9-10H2,1-3H3,(H,19,20) |
| InChIKey | PTEKADVJSRQLSV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |