C16H23NO3 — CID 62934041
5-(N-ethyl-2-methylanilino)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 62934041) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 5-(N-ethyl-2-methylanilino)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(N-ethyl-2-methylanilino)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62934041 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 5-(N-ethyl-2-methylanilino)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CCN(C(=O)CC(C)(C)CC(=O)O)c1ccccc1C |
| InChI | InChI=1S/C16H23NO3/c1-5-17(13-9-7-6-8-12(13)2)14(18)10-16(3,4)11-15(19)20/h6-9H,5,10-11H2,1-4H3,(H,19,20) |
| InChIKey | OQHHEDWTYDPEBE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |