C27H30N2O2 — CID 3396233
N,N'-diethyl-N,N'-bis(2-methylphenyl)-2-phenylpropanediamide (PubChem CID 3396233) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is N,N'-diethyl-N,N'-bis(2-methylphenyl)-2-phenylpropanediamide.
| Compound Name | N,N'-diethyl-N,N'-bis(2-methylphenyl)-2-phenylpropanediamide |
|---|---|
| PubChem CID | 3396233 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N,N'-diethyl-N,N'-bis(2-methylphenyl)-2-phenylpropanediamide |
| SMILES | CCN(C(=O)C(C(=O)N(CC)c1ccccc1C)c1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C27H30N2O2/c1-5-28(23-18-12-10-14-20(23)3)26(30)25(22-16-8-7-9-17-22)27(31)29(6-2)24-19-13-11-15-21(24)4/h7-19,25H,5-6H2,1-4H3 |
| InChIKey | JHMPICAINHYRBA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|