C11H13F2NO — CID 103515266
N-ethyl-2,2-difluoro-N-(2-methylphenyl)acetamide (PubChem CID 103515266) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is N-ethyl-2,2-difluoro-N-(2-methylphenyl)acetamide.
| Compound Name | N-ethyl-2,2-difluoro-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 103515266 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-ethyl-2,2-difluoro-N-(2-methylphenyl)acetamide |
| SMILES | CCN(C(=O)C(F)F)c1ccccc1C |
| InChI | InChI=1S/C11H13F2NO/c1-3-14(11(15)10(12)13)9-7-5-4-6-8(9)2/h4-7,10H,3H2,1-2H3 |
| InChIKey | DEEDVVMSEWBRKO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |