C8H10FNO2 — CID 165177896
2-fluoro-N,N-dimethoxyaniline (PubChem CID 165177896) has the molecular formula C8H10FNO2 and a molecular weight of 171.17 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethoxyaniline.
| Compound Name | 2-fluoro-N,N-dimethoxyaniline |
|---|---|
| PubChem CID | 165177896 |
| Molecular Formula | C8H10FNO2 |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 2-fluoro-N,N-dimethoxyaniline |
| SMILES | CON(OC)c1ccccc1F |
| InChI | InChI=1S/C8H10FNO2/c1-11-10(12-2)8-6-4-3-5-7(8)9/h3-6H,1-2H3 |
| InChIKey | YFCYPATUCXEQJL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|