C22H16F2N4 — CID 21058556
2,5-bis(2-fluoro-N-methylanilino)benzene-1,4-dicarbonitrile (PubChem CID 21058556) has the molecular formula C22H16F2N4 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2,5-bis(2-fluoro-N-methylanilino)benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis(2-fluoro-N-methylanilino)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 21058556 |
| Molecular Formula | C22H16F2N4 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2,5-bis(2-fluoro-N-methylanilino)benzene-1,4-dicarbonitrile |
| SMILES | CN(c1ccccc1F)c1cc(C#N)c(N(C)c2ccccc2F)cc1C#N |
| InChI | InChI=1S/C22H16F2N4/c1-27(19-9-5-3-7-17(19)23)21-11-16(14-26)22(12-15(21)13-25)28(2)20-10-6-4-8-18(20)24/h3-12H,1-2H3 |
| InChIKey | PQCCEKUPYNCUPT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |