C8H10N2O4-2 — CID 163652520
1-N,2-N-dimethoxy-1-N,2-N-dioxidobenzene-1,2-diamine (PubChem CID 163652520) has the molecular formula C8H10N2O4-2 and a molecular weight of 198.18 g/mol. Its IUPAC name is 1-N,2-N-dimethoxy-1-N,2-N-dioxidobenzene-1,2-diamine.
| Compound Name | 1-N,2-N-dimethoxy-1-N,2-N-dioxidobenzene-1,2-diamine |
|---|---|
| PubChem CID | 163652520 |
| Molecular Formula | C8H10N2O4-2 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1-N,2-N-dimethoxy-1-N,2-N-dioxidobenzene-1,2-diamine |
| SMILES | CON([O-])c1ccccc1N([O-])OC |
| InChI | InChI=1S/C8H10N2O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3/q-2 |
| InChIKey | NJXDMGLYGXWLNY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|