C13H21FN2O — CID 54935456
N'-(2-fluorophenyl)-N'-(3-methoxypropyl)propane-1,3-diamine (PubChem CID 54935456) has the molecular formula C13H21FN2O and a molecular weight of 240.32 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-N'-(3-methoxypropyl)propane-1,3-diamine.
| Compound Name | N'-(2-fluorophenyl)-N'-(3-methoxypropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 54935456 |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N'-(2-fluorophenyl)-N'-(3-methoxypropyl)propane-1,3-diamine |
| SMILES | COCCCN(CCCN)c1ccccc1F |
| InChI | InChI=1S/C13H21FN2O/c1-17-11-5-10-16(9-4-8-15)13-7-3-2-6-12(13)14/h2-3,6-7H,4-5,8-11,15H2,1H3 |
| InChIKey | QHFRIKIJRNYQDZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|