C12H20FN3O3S — CID 114813776
1-[3-aminopropyl(2-methoxyethylsulfamoyl)amino]-2-fluorobenzene (PubChem CID 114813776) has the molecular formula C12H20FN3O3S and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-[3-aminopropyl(2-methoxyethylsulfamoyl)amino]-2-fluorobenzene.
| Compound Name | 1-[3-aminopropyl(2-methoxyethylsulfamoyl)amino]-2-fluorobenzene |
|---|---|
| PubChem CID | 114813776 |
| Molecular Formula | C12H20FN3O3S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-[3-aminopropyl(2-methoxyethylsulfamoyl)amino]-2-fluorobenzene |
| SMILES | COCCNS(=O)(=O)N(CCCN)c1ccccc1F |
| InChI | InChI=1S/C12H20FN3O3S/c1-19-10-8-15-20(17,18)16(9-4-7-14)12-6-3-2-5-11(12)13/h2-3,5-6,15H,4,7-10,14H2,1H3 |
| InChIKey | VOUCGSYRBDXWFQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|