C10H15FN2O4S2 — CID 113069709
N-[2-(2-fluoro-N-methylsulfonylanilino)ethyl]methanesulfonamide (PubChem CID 113069709) has the molecular formula C10H15FN2O4S2 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[2-(2-fluoro-N-methylsulfonylanilino)ethyl]methanesulfonamide.
| Compound Name | N-[2-(2-fluoro-N-methylsulfonylanilino)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113069709 |
| Molecular Formula | C10H15FN2O4S2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | N-[2-(2-fluoro-N-methylsulfonylanilino)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN(c1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C10H15FN2O4S2/c1-18(14,15)12-7-8-13(19(2,16)17)10-6-4-3-5-9(10)11/h3-6,12H,7-8H2,1-2H3 |
| InChIKey | BLRBLAPIBHVXKJ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |