C13H15FN2O4S3 — CID 113069717
N-[2-(2-fluoro-N-methylsulfonylanilino)ethyl]thiophene-2-sulfonamide (PubChem CID 113069717) has the molecular formula C13H15FN2O4S3 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-[2-(2-fluoro-N-methylsulfonylanilino)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(2-fluoro-N-methylsulfonylanilino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113069717 |
| Molecular Formula | C13H15FN2O4S3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-[2-(2-fluoro-N-methylsulfonylanilino)ethyl]thiophene-2-sulfonamide |
| SMILES | CS(=O)(=O)N(CCNS(=O)(=O)c1cccs1)c1ccccc1F |
| InChI | InChI=1S/C13H15FN2O4S3/c1-22(17,18)16(12-6-3-2-5-11(12)14)9-8-15-23(19,20)13-7-4-10-21-13/h2-7,10,15H,8-9H2,1H3 |
| InChIKey | IHZSRACZBKKGOT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |