C14H17FN2O4S3 — CID 113066996
N-[2-[(4-fluorophenyl)methyl-methylsulfonylamino]ethyl]thiophene-2-sulfonamide (PubChem CID 113066996) has the molecular formula C14H17FN2O4S3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-methylsulfonylamino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-methylsulfonylamino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113066996 |
| Molecular Formula | C14H17FN2O4S3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-methylsulfonylamino]ethyl]thiophene-2-sulfonamide |
| SMILES | CS(=O)(=O)N(CCNS(=O)(=O)c1cccs1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FN2O4S3/c1-23(18,19)17(11-12-4-6-13(15)7-5-12)9-8-16-24(20,21)14-3-2-10-22-14/h2-7,10,16H,8-9,11H2,1H3 |
| InChIKey | PBGHEJIWXFHSRI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |